a-Fluoro-b-alanine
Catalog No: FT-0668601
CAS No: 3821-81-6
- Chemical Name: a-Fluoro-b-alanine
- Molecular Formula: C3H7ClFNO2
- Molecular Weight: 143.54
- InChI Key: CVYOZQFAVJXJTK-UHFFFAOYSA-N
- InChI: InChI=1S/C3H6FNO2.ClH/c4-2(1-5)3(6)7;/h2H,1,5H2,(H,6,7);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 3821-81-6 |
| Flash_Point: | 113.8ºC |
| Product_Name: | 3-Amino-2-fluoropropionic acid |
| Bolling_Point: | 264.5ºC at 760 mmHg |
| FW: | 107.08400 |
| Melting_Point: | 222ºC |
| MF: | C3H6FNO2 |
| Density: | 1.302g/cm3 |
| Melting_Point: | 222ºC |
|---|---|
| Refractive_Index: | 1.428 |
| MF: | C3H6FNO2 |
| Flash_Point: | 113.8ºC |
| LogP: | 0.06810 |
| FW: | 107.08400 |
| Density: | 1.302g/cm3 |
| PSA: | 63.32000 |
| Bolling_Point: | 264.5ºC at 760 mmHg |
| Exact_Mass: | 107.03800 |
| Symbol: | GHS05, GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2922499990 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)